C30H46N4O9 — CID 176880725
propyl (E)-3-[4-[(E)-3-[4-[(E)-3-[4-[(E)-3-(2-methoxyethoxy)-3-oxoprop-1-enyl]piperazin-1-yl]prop-2-enoyl]oxybutoxy]-3-oxoprop-1-enyl]piperazin-1-yl]prop-2-enoate (PubChem CID 176880725) has the molecular formula C30H46N4O9 and a molecular weight of 606.72 g/mol. Its IUPAC name is propyl (E)-3-[4-[(E)-3-[4-[(E)-3-[4-[(E)-3-(2-methoxyethoxy)-3-oxoprop-1-enyl]piperazin-1-yl]prop-2-enoyl]oxybutoxy]-3-oxoprop-1-enyl]piperazin-1-yl]prop-2-enoate.
| Compound Name | propyl (E)-3-[4-[(E)-3-[4-[(E)-3-[4-[(E)-3-(2-methoxyethoxy)-3-oxoprop-1-enyl]piperazin-1-yl]prop-2-enoyl]oxybutoxy]-3-oxoprop-1-enyl]piperazin-1-yl]prop-2-enoate |
|---|---|
| PubChem CID | 176880725 |
| Molecular Formula | C30H46N4O9 |
| Molecular Weight | 606.72 g/mol |
| Exact Mass | 606.33 |
| IUPAC Name | propyl (E)-3-[4-[(E)-3-[4-[(E)-3-[4-[(E)-3-(2-methoxyethoxy)-3-oxoprop-1-enyl]piperazin-1-yl]prop-2-enoyl]oxybutoxy]-3-oxoprop-1-enyl]piperazin-1-yl]prop-2-enoate |
| SMILES | CCCOC(=O)/C=C/N1CCN(/C=C/C(=O)OCCCCOC(=O)/C=C/N2CCN(/C=C/C(=O)OCCOC)CC2)CC1 |
| InChI | InChI=1S/C30H46N4O9/c1-3-22-40-27(35)6-10-31-14-16-32(17-15-31)11-7-28(36)41-23-4-5-24-42-29(37)8-12-33-18-20-34(21-19-33)13-9-30(38)43-26-25-39-2/h6-13H,3-5,14-26H2,1-2H3/b10-6+,11-7+,12-8+,13-9+ |
| InChIKey | BCNNUWSUMGVAMN-LKHRVSKSSA-N |
| XLogP | 1.29 |
| TPSA | 127.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 606.72 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|