C16H27NO5 — CID 176880471
3-[(E)-3-[4-hydroxybutyl(methyl)amino]prop-2-enoyl]oxybutyl (E)-but-2-enoate (PubChem CID 176880471) has the molecular formula C16H27NO5 and a molecular weight of 313.39 g/mol. Its IUPAC name is 3-[(E)-3-[4-hydroxybutyl(methyl)amino]prop-2-enoyl]oxybutyl (E)-but-2-enoate.
| Compound Name | 3-[(E)-3-[4-hydroxybutyl(methyl)amino]prop-2-enoyl]oxybutyl (E)-but-2-enoate |
|---|---|
| PubChem CID | 176880471 |
| Molecular Formula | C16H27NO5 |
| Molecular Weight | 313.39 g/mol |
| Exact Mass | 313.19 |
| IUPAC Name | 3-[(E)-3-[4-hydroxybutyl(methyl)amino]prop-2-enoyl]oxybutyl (E)-but-2-enoate |
| SMILES | C/C=C/C(=O)OCCC(C)OC(=O)/C=C/N(C)CCCCO |
| InChI | InChI=1S/C16H27NO5/c1-4-7-15(19)21-13-9-14(2)22-16(20)8-11-17(3)10-5-6-12-18/h4,7-8,11,14,18H,5-6,9-10,12-13H2,1-3H3/b7-4+,11-8+ |
| InChIKey | IOHAKWQXBHWXOO-VCABWLAWSA-N |
| XLogP | 1.65 |
| TPSA | 76.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.39 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|