C16H27NO5S2 — CID 176880527
2-[2-[(E)-3-[4-hydroxybutyl(methyl)amino]prop-2-enoyl]oxyethyldisulfanyl]ethyl (E)-but-2-enoate (PubChem CID 176880527) has the molecular formula C16H27NO5S2 and a molecular weight of 377.53 g/mol. Its IUPAC name is 2-[2-[(E)-3-[4-hydroxybutyl(methyl)amino]prop-2-enoyl]oxyethyldisulfanyl]ethyl (E)-but-2-enoate.
| Compound Name | 2-[2-[(E)-3-[4-hydroxybutyl(methyl)amino]prop-2-enoyl]oxyethyldisulfanyl]ethyl (E)-but-2-enoate |
|---|---|
| PubChem CID | 176880527 |
| Molecular Formula | C16H27NO5S2 |
| Molecular Weight | 377.53 g/mol |
| Exact Mass | 377.13 |
| IUPAC Name | 2-[2-[(E)-3-[4-hydroxybutyl(methyl)amino]prop-2-enoyl]oxyethyldisulfanyl]ethyl (E)-but-2-enoate |
| SMILES | C/C=C/C(=O)OCCSSCCOC(=O)/C=C/N(C)CCCCO |
| InChI | InChI=1S/C16H27NO5S2/c1-3-6-15(19)21-11-13-23-24-14-12-22-16(20)7-9-17(2)8-4-5-10-18/h3,6-7,9,18H,4-5,8,10-14H2,1-2H3/b6-3+,9-7+ |
| InChIKey | ILDCZEKXOVDVLC-PJVVBUPDSA-N |
| XLogP | 2.25 |
| TPSA | 76.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.53 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|