C32H30Cl2F2N8O8S — CID 176884137
bis[(E)-[4-chloro-6-[4-fluoro-2-(3-methoxycyclobutyl)oxyanilino]pyrimidin-5-yl]methylideneamino] sulfate (PubChem CID 176884137) has the molecular formula C32H30Cl2F2N8O8S and a molecular weight of 795.61 g/mol. Its IUPAC name is bis[(E)-[4-chloro-6-[4-fluoro-2-(3-methoxycyclobutyl)oxyanilino]pyrimidin-5-yl]methylideneamino] sulfate.
| Compound Name | bis[(E)-[4-chloro-6-[4-fluoro-2-(3-methoxycyclobutyl)oxyanilino]pyrimidin-5-yl]methylideneamino] sulfate |
|---|---|
| PubChem CID | 176884137 |
| Molecular Formula | C32H30Cl2F2N8O8S |
| Molecular Weight | 795.61 g/mol |
| Exact Mass | 794.13 |
| IUPAC Name | bis[(E)-[4-chloro-6-[4-fluoro-2-(3-methoxycyclobutyl)oxyanilino]pyrimidin-5-yl]methylideneamino] sulfate |
| SMILES | COC1CC(Oc2cc(F)ccc2Nc2ncnc(Cl)c2/C=N/OS(=O)(=O)O/N=C/c2c(Cl)ncnc2Nc2ccc(F)cc2OC2CC(OC)C2)C1 |
| InChI | InChI=1S/C32H30Cl2F2N8O8S/c1-47-19-9-21(10-19)49-27-7-17(35)3-5-25(27)43-31-23(29(33)37-15-39-31)13-41-51-53(45,46)52-42-14-24-30(34)38-16-40-32(24)44-26-6-4-18(36)8-28(26)50-22-11-20(12-22)48-2/h3-8,13-16,19-22H,9-12H2,1-2H3,(H,37,39,43)(H,38,40,44)/b41-13+,42-14+ |
| InChIKey | PXJMUOYLPCPDDS-YVDHPGQQSA-N |
| XLogP | 6.10 |
| TPSA | 189.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 16 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 53 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 795.61 |
| LogP ≤ 5 | 6.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 16 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|