C6H12N4O — CID 176888625
(1S)-1-(3-ethoxy-1H-1,2,4-triazol-5-yl)ethanamine (PubChem CID 176888625) has the molecular formula C6H12N4O and a molecular weight of 156.19 g/mol. Its IUPAC name is (1S)-1-(3-ethoxy-1H-1,2,4-triazol-5-yl)ethanamine.
| Compound Name | (1S)-1-(3-ethoxy-1H-1,2,4-triazol-5-yl)ethanamine |
|---|---|
| PubChem CID | 176888625 |
| Molecular Formula | C6H12N4O |
| Molecular Weight | 156.19 g/mol |
| Exact Mass | 156.10 |
| IUPAC Name | (1S)-1-(3-ethoxy-1H-1,2,4-triazol-5-yl)ethanamine |
| SMILES | CCOc1n[nH]c([C@H](C)N)n1 |
| InChI | InChI=1S/C6H12N4O/c1-3-11-6-8-5(4(2)7)9-10-6/h4H,3,7H2,1-2H3,(H,8,9,10)/t4-/m0/s1 |
| InChIKey | DTSSUVRATFWMFJ-BYPYZUCNSA-N |
| XLogP | 0.22 |
| TPSA | 76.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 156.19 |
| LogP ≤ 5 | 0.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |