C8H9NO2 — CID 176888655
2-methyl-6,7-dihydro-5H-furo[3,2-c]pyridin-4-one (PubChem CID 176888655) has the molecular formula C8H9NO2 and a molecular weight of 151.16 g/mol. Its IUPAC name is 2-methyl-6,7-dihydro-5H-furo[3,2-c]pyridin-4-one.
| Compound Name | 2-methyl-6,7-dihydro-5H-furo[3,2-c]pyridin-4-one |
|---|---|
| PubChem CID | 176888655 |
| Molecular Formula | C8H9NO2 |
| Molecular Weight | 151.16 g/mol |
| Exact Mass | 151.06 |
| IUPAC Name | 2-methyl-6,7-dihydro-5H-furo[3,2-c]pyridin-4-one |
| SMILES | Cc1cc2c(o1)CCNC2=O |
| InChI | InChI=1S/C8H9NO2/c1-5-4-6-7(11-5)2-3-9-8(6)10/h4H,2-3H2,1H3,(H,9,10) |
| InChIKey | QUNUTVRTTVKAAL-UHFFFAOYSA-N |
| XLogP | 0.87 |
| TPSA | 42.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 151.16 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |