C28H43N3O8S — CID 176888912
2-[1-[[3-[(1S)-2-[(1S,3S,5S)-3-cyano-2-azabicyclo[3.1.0]hexan-2-yl]-1-[(2-methylpropan-2-yl)oxycarbonylamino]-2-oxoethyl]-1-adamantyl]oxy]ethoxy]ethyl methanesulfonate (PubChem CID 176888912) has the molecular formula C28H43N3O8S and a molecular weight of 581.73 g/mol. Its IUPAC name is 2-[1-[[3-[(1S)-2-[(1S,3S,5S)-3-cyano-2-azabicyclo[3.1.0]hexan-2-yl]-1-[(2-methylpropan-2-yl)oxycarbonylamino]-2-oxoethyl]-1-adamantyl]oxy]ethoxy]ethyl methanesulfonate.
| Compound Name | 2-[1-[[3-[(1S)-2-[(1S,3S,5S)-3-cyano-2-azabicyclo[3.1.0]hexan-2-yl]-1-[(2-methylpropan-2-yl)oxycarbonylamino]-2-oxoethyl]-1-adamantyl]oxy]ethoxy]ethyl methanesulfonate |
|---|---|
| PubChem CID | 176888912 |
| Molecular Formula | C28H43N3O8S |
| Molecular Weight | 581.73 g/mol |
| Exact Mass | 581.28 |
| IUPAC Name | 2-[1-[[3-[(1S)-2-[(1S,3S,5S)-3-cyano-2-azabicyclo[3.1.0]hexan-2-yl]-1-[(2-methylpropan-2-yl)oxycarbonylamino]-2-oxoethyl]-1-adamantyl]oxy]ethoxy]ethyl methanesulfonate |
| SMILES | CC(OCCOS(C)(=O)=O)OC12CC3CC(C1)CC([C@H](NC(=O)OC(C)(C)C)C(=O)N1[C@H](C#N)C[C@@H]4C[C@@H]41)(C3)C2 |
| InChI | InChI=1S/C28H43N3O8S/c1-17(36-6-7-37-40(5,34)35)38-28-13-18-8-19(14-28)12-27(11-18,16-28)23(30-25(33)39-26(2,3)4)24(32)31-21(15-29)9-20-10-22(20)31/h17-23H,6-14,16H2,1-5H3,(H,30,33)/t17?,18?,19?,20-,21+,22+,23-,27?,28?/m1/s1 |
| InChIKey | WQJOJMPSWVQIAL-ZSXRKSDSSA-N |
| XLogP | 3.09 |
| TPSA | 144.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 581.73 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|