C36H44FN5O3 — CID 176889942
6-[7-(8-ethyl-7-fluoro-3-hydroxynaphthalen-1-yl)-2-[(6-methylidene-2,3,5,7-tetrahydro-1H-pyrrolizin-8-yl)methoxy]-6,8-dihydro-5H-pyrido[3,4-d]pyrimidin-4-yl]-6-azaspiro[3.5]nonan-2-ol (PubChem CID 176889942) has the molecular formula C36H44FN5O3 and a molecular weight of 613.78 g/mol. Its IUPAC name is 6-[7-(8-ethyl-7-fluoro-3-hydroxynaphthalen-1-yl)-2-[(6-methylidene-2,3,5,7-tetrahydro-1H-pyrrolizin-8-yl)methoxy]-6,8-dihydro-5H-pyrido[3,4-d]pyrimidin-4-yl]-6-azaspiro[3.5]nonan-2-ol.
| Compound Name | 6-[7-(8-ethyl-7-fluoro-3-hydroxynaphthalen-1-yl)-2-[(6-methylidene-2,3,5,7-tetrahydro-1H-pyrrolizin-8-yl)methoxy]-6,8-dihydro-5H-pyrido[3,4-d]pyrimidin-4-yl]-6-azaspiro[3.5]nonan-2-ol |
|---|---|
| PubChem CID | 176889942 |
| Molecular Formula | C36H44FN5O3 |
| Molecular Weight | 613.78 g/mol |
| Exact Mass | 613.34 |
| IUPAC Name | 6-[7-(8-ethyl-7-fluoro-3-hydroxynaphthalen-1-yl)-2-[(6-methylidene-2,3,5,7-tetrahydro-1H-pyrrolizin-8-yl)methoxy]-6,8-dihydro-5H-pyrido[3,4-d]pyrimidin-4-yl]-6-azaspiro[3.5]nonan-2-ol |
| SMILES | C=C1CN2CCCC2(COc2nc3c(c(N4CCCC5(CC(O)C5)C4)n2)CCN(c2cc(O)cc4ccc(F)c(CC)c24)C3)C1 |
| InChI | InChI=1S/C36H44FN5O3/c1-3-27-29(37)7-6-24-14-25(43)15-31(32(24)27)40-13-8-28-30(20-40)38-34(45-22-36-10-5-12-42(36)19-23(2)16-36)39-33(28)41-11-4-9-35(21-41)17-26(44)18-35/h6-7,14-15,26,43-44H,2-5,8-13,16-22H2,1H3 |
| InChIKey | VMRXCFJIYVHODK-UHFFFAOYSA-N |
| XLogP | 5.51 |
| TPSA | 85.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 613.78 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|