C33H41N5O5Si — CID 176891349
tert-butyl 2-[5-[[(1R)-1-dibenzofuran-2-ylethyl]amino]-6-oxo-2-[1-(2-trimethylsilylethoxymethyl)pyrazol-4-yl]pyrimidin-1-yl]acetate (PubChem CID 176891349) has the molecular formula C33H41N5O5Si and a molecular weight of 615.81 g/mol. Its IUPAC name is tert-butyl 2-[5-[[(1R)-1-dibenzofuran-2-ylethyl]amino]-6-oxo-2-[1-(2-trimethylsilylethoxymethyl)pyrazol-4-yl]pyrimidin-1-yl]acetate.
| Compound Name | tert-butyl 2-[5-[[(1R)-1-dibenzofuran-2-ylethyl]amino]-6-oxo-2-[1-(2-trimethylsilylethoxymethyl)pyrazol-4-yl]pyrimidin-1-yl]acetate |
|---|---|
| PubChem CID | 176891349 |
| Molecular Formula | C33H41N5O5Si |
| Molecular Weight | 615.81 g/mol |
| Exact Mass | 615.29 |
| IUPAC Name | tert-butyl 2-[5-[[(1R)-1-dibenzofuran-2-ylethyl]amino]-6-oxo-2-[1-(2-trimethylsilylethoxymethyl)pyrazol-4-yl]pyrimidin-1-yl]acetate |
| SMILES | C[C@@H](Nc1cnc(-c2cnn(COCC[Si](C)(C)C)c2)n(CC(=O)OC(C)(C)C)c1=O)c1ccc2oc3ccccc3c2c1 |
| InChI | InChI=1S/C33H41N5O5Si/c1-22(23-12-13-29-26(16-23)25-10-8-9-11-28(25)42-29)36-27-18-34-31(38(32(27)40)20-30(39)43-33(2,3)4)24-17-35-37(19-24)21-41-14-15-44(5,6)7/h8-13,16-19,22,36H,14-15,20-21H2,1-7H3/t22-/m1/s1 |
| InChIKey | FLVRSKPXNVNYSS-JOCHJYFZSA-N |
| XLogP | 6.83 |
| TPSA | 113.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 615.81 |
| LogP ≤ 5 | 6.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|