C37H42N6O5 — CID 170789121
tert-butyl 2-[2-[4-(7-azidoheptoxy)phenyl]-5-[[(1R)-1-dibenzofuran-2-ylethyl]amino]-6-oxopyrimidin-1-yl]acetate (PubChem CID 170789121) has the molecular formula C37H42N6O5 and a molecular weight of 650.78 g/mol. Its IUPAC name is tert-butyl 2-[2-[4-(7-azidoheptoxy)phenyl]-5-[[(1R)-1-dibenzofuran-2-ylethyl]amino]-6-oxopyrimidin-1-yl]acetate.
| Compound Name | tert-butyl 2-[2-[4-(7-azidoheptoxy)phenyl]-5-[[(1R)-1-dibenzofuran-2-ylethyl]amino]-6-oxopyrimidin-1-yl]acetate |
|---|---|
| PubChem CID | 170789121 |
| Molecular Formula | C37H42N6O5 |
| Molecular Weight | 650.78 g/mol |
| Exact Mass | 650.32 |
| IUPAC Name | tert-butyl 2-[2-[4-(7-azidoheptoxy)phenyl]-5-[[(1R)-1-dibenzofuran-2-ylethyl]amino]-6-oxopyrimidin-1-yl]acetate |
| SMILES | C[C@@H](Nc1cnc(-c2ccc(OCCCCCCCN=[N+]=[N-])cc2)n(CC(=O)OC(C)(C)C)c1=O)c1ccc2oc3ccccc3c2c1 |
| InChI | InChI=1S/C37H42N6O5/c1-25(27-16-19-33-30(22-27)29-12-8-9-13-32(29)47-33)41-31-23-39-35(43(36(31)45)24-34(44)48-37(2,3)4)26-14-17-28(18-15-26)46-21-11-7-5-6-10-20-40-42-38/h8-9,12-19,22-23,25,41H,5-7,10-11,20-21,24H2,1-4H3/t25-/m1/s1 |
| InChIKey | YDVMIKLQGLOIJI-RUZDIDTESA-N |
| XLogP | 8.96 |
| TPSA | 144.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 650.78 |
| LogP ≤ 5 | 8.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|