C26H31N3O4 — CID 170789760
tert-butyl 2-[5-[3-(4-methoxyphenyl)propylamino]-6-oxo-2-phenylpyrimidin-1-yl]acetate (PubChem CID 170789760) has the molecular formula C26H31N3O4 and a molecular weight of 449.55 g/mol. Its IUPAC name is tert-butyl 2-[5-[3-(4-methoxyphenyl)propylamino]-6-oxo-2-phenylpyrimidin-1-yl]acetate.
| Compound Name | tert-butyl 2-[5-[3-(4-methoxyphenyl)propylamino]-6-oxo-2-phenylpyrimidin-1-yl]acetate |
|---|---|
| PubChem CID | 170789760 |
| Molecular Formula | C26H31N3O4 |
| Molecular Weight | 449.55 g/mol |
| Exact Mass | 449.23 |
| IUPAC Name | tert-butyl 2-[5-[3-(4-methoxyphenyl)propylamino]-6-oxo-2-phenylpyrimidin-1-yl]acetate |
| SMILES | COc1ccc(CCCNc2cnc(-c3ccccc3)n(CC(=O)OC(C)(C)C)c2=O)cc1 |
| InChI | InChI=1S/C26H31N3O4/c1-26(2,3)33-23(30)18-29-24(20-10-6-5-7-11-20)28-17-22(25(29)31)27-16-8-9-19-12-14-21(32-4)15-13-19/h5-7,10-15,17,27H,8-9,16,18H2,1-4H3 |
| InChIKey | QNJOQYSWPXTSOE-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 82.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.55 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|