C29H25F2N3O — CID 170789614
5-[3-(9,9-difluorofluoren-3-yl)propylamino]-2-phenyl-3-prop-2-enylpyrimidin-4-one (PubChem CID 170789614) has the molecular formula C29H25F2N3O and a molecular weight of 469.54 g/mol. Its IUPAC name is 5-[3-(9,9-difluorofluoren-3-yl)propylamino]-2-phenyl-3-prop-2-enylpyrimidin-4-one.
| Compound Name | 5-[3-(9,9-difluorofluoren-3-yl)propylamino]-2-phenyl-3-prop-2-enylpyrimidin-4-one |
|---|---|
| PubChem CID | 170789614 |
| Molecular Formula | C29H25F2N3O |
| Molecular Weight | 469.54 g/mol |
| Exact Mass | 469.20 |
| IUPAC Name | 5-[3-(9,9-difluorofluoren-3-yl)propylamino]-2-phenyl-3-prop-2-enylpyrimidin-4-one |
| SMILES | C=CCn1c(-c2ccccc2)ncc(NCCCc2ccc3c(c2)-c2ccccc2C3(F)F)c1=O |
| InChI | InChI=1S/C29H25F2N3O/c1-2-17-34-27(21-10-4-3-5-11-21)33-19-26(28(34)35)32-16-8-9-20-14-15-25-23(18-20)22-12-6-7-13-24(22)29(25,30)31/h2-7,10-15,18-19,32H,1,8-9,16-17H2 |
| InChIKey | VOQVZYBVFKYTTG-UHFFFAOYSA-N |
| XLogP | 6.26 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.54 |
| LogP ≤ 5 | 6.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|