C27H23N3O3 — CID 170790246
5-(dibenzofuran-2-ylmethylamino)-2-(4-methoxyphenyl)-3-prop-2-enylpyrimidin-4-one (PubChem CID 170790246) has the molecular formula C27H23N3O3 and a molecular weight of 437.50 g/mol. Its IUPAC name is 5-(dibenzofuran-2-ylmethylamino)-2-(4-methoxyphenyl)-3-prop-2-enylpyrimidin-4-one.
| Compound Name | 5-(dibenzofuran-2-ylmethylamino)-2-(4-methoxyphenyl)-3-prop-2-enylpyrimidin-4-one |
|---|---|
| PubChem CID | 170790246 |
| Molecular Formula | C27H23N3O3 |
| Molecular Weight | 437.50 g/mol |
| Exact Mass | 437.17 |
| IUPAC Name | 5-(dibenzofuran-2-ylmethylamino)-2-(4-methoxyphenyl)-3-prop-2-enylpyrimidin-4-one |
| SMILES | C=CCn1c(-c2ccc(OC)cc2)ncc(NCc2ccc3oc4ccccc4c3c2)c1=O |
| InChI | InChI=1S/C27H23N3O3/c1-3-14-30-26(19-9-11-20(32-2)12-10-19)29-17-23(27(30)31)28-16-18-8-13-25-22(15-18)21-6-4-5-7-24(21)33-25/h3-13,15,17,28H,1,14,16H2,2H3 |
| InChIKey | FGCVBPNYTFIJCT-UHFFFAOYSA-N |
| XLogP | 5.62 |
| TPSA | 69.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.50 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|