C36H46N4O — CID 170789225
butane;(E)-N,2-dimethyl-3-(4-propyl-3-pyridinyl)prop-2-en-1-amine;2,5-diphenyl-3-prop-2-enylpyrimidin-4-one (PubChem CID 170789225) has the molecular formula C36H46N4O and a molecular weight of 550.79 g/mol. Its IUPAC name is butane;(E)-N,2-dimethyl-3-(4-propyl-3-pyridinyl)prop-2-en-1-amine;2,5-diphenyl-3-prop-2-enylpyrimidin-4-one.
| Compound Name | butane;(E)-N,2-dimethyl-3-(4-propyl-3-pyridinyl)prop-2-en-1-amine;2,5-diphenyl-3-prop-2-enylpyrimidin-4-one |
|---|---|
| PubChem CID | 170789225 |
| Molecular Formula | C36H46N4O |
| Molecular Weight | 550.79 g/mol |
| Exact Mass | 550.37 |
| IUPAC Name | butane;(E)-N,2-dimethyl-3-(4-propyl-3-pyridinyl)prop-2-en-1-amine;2,5-diphenyl-3-prop-2-enylpyrimidin-4-one |
| SMILES | C=CCn1c(-c2ccccc2)ncc(-c2ccccc2)c1=O.CCCC.CCCc1ccncc1/C=C(\C)CNC |
| InChI | InChI=1S/C19H16N2O.C13H20N2.C4H10/c1-2-13-21-18(16-11-7-4-8-12-16)20-14-17(19(21)22)15-9-5-3-6-10-15;1-4-5-12-6-7-15-10-13(12)8-11(2)9-14-3;1-3-4-2/h2-12,14H,1,13H2;6-8,10,14H,4-5,9H2,1-3H3;3-4H2,1-2H3/b;11-8+; |
| InChIKey | YFFHWMDCDIFYDN-GRQPBFIBSA-N |
| XLogP | 8.23 |
| TPSA | 59.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.79 |
| LogP ≤ 5 | 8.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|