C40H58N4O — CID 170790238
butane;(E)-N,2-dimethyl-3-(4-propyl-3-pyridinyl)prop-2-en-1-amine;6-phenyl-3-(3-phenylpropylamino)-1-prop-2-enylpiperidin-2-one (PubChem CID 170790238) has the molecular formula C40H58N4O and a molecular weight of 610.93 g/mol. Its IUPAC name is butane;(E)-N,2-dimethyl-3-(4-propyl-3-pyridinyl)prop-2-en-1-amine;6-phenyl-3-(3-phenylpropylamino)-1-prop-2-enylpiperidin-2-one.
| Compound Name | butane;(E)-N,2-dimethyl-3-(4-propyl-3-pyridinyl)prop-2-en-1-amine;6-phenyl-3-(3-phenylpropylamino)-1-prop-2-enylpiperidin-2-one |
|---|---|
| PubChem CID | 170790238 |
| Molecular Formula | C40H58N4O |
| Molecular Weight | 610.93 g/mol |
| Exact Mass | 610.46 |
| IUPAC Name | butane;(E)-N,2-dimethyl-3-(4-propyl-3-pyridinyl)prop-2-en-1-amine;6-phenyl-3-(3-phenylpropylamino)-1-prop-2-enylpiperidin-2-one |
| SMILES | C=CCN1C(=O)C(NCCCc2ccccc2)CCC1c1ccccc1.CCCC.CCCc1ccncc1/C=C(\C)CNC |
| InChI | InChI=1S/C23H28N2O.C13H20N2.C4H10/c1-2-18-25-22(20-13-7-4-8-14-20)16-15-21(23(25)26)24-17-9-12-19-10-5-3-6-11-19;1-4-5-12-6-7-15-10-13(12)8-11(2)9-14-3;1-3-4-2/h2-8,10-11,13-14,21-22,24H,1,9,12,15-18H2;6-8,10,14H,4-5,9H2,1-3H3;3-4H2,1-2H3/b;11-8+; |
| InChIKey | DDGRRILLZDQCMR-GRQPBFIBSA-N |
| XLogP | 8.59 |
| TPSA | 57.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 610.93 |
| LogP ≤ 5 | 8.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|