C21H26N4O2 — CID 52514055
(2R)-N-[2-[benzyl(ethyl)amino]-2-oxoethyl]-2-pyridin-4-ylpyrrolidine-1-carboxamide (PubChem CID 52514055) has the molecular formula C21H26N4O2 and a molecular weight of 366.47 g/mol. Its IUPAC name is (2R)-N-[2-[benzyl(ethyl)amino]-2-oxoethyl]-2-pyridin-4-ylpyrrolidine-1-carboxamide.
| Compound Name | (2R)-N-[2-[benzyl(ethyl)amino]-2-oxoethyl]-2-pyridin-4-ylpyrrolidine-1-carboxamide |
|---|---|
| PubChem CID | 52514055 |
| Molecular Formula | C21H26N4O2 |
| Molecular Weight | 366.47 g/mol |
| Exact Mass | 366.21 |
| IUPAC Name | (2R)-N-[2-[benzyl(ethyl)amino]-2-oxoethyl]-2-pyridin-4-ylpyrrolidine-1-carboxamide |
| SMILES | CCN(Cc1ccccc1)C(=O)CNC(=O)N1CCC[C@@H]1c1ccncc1 |
| InChI | InChI=1S/C21H26N4O2/c1-2-24(16-17-7-4-3-5-8-17)20(26)15-23-21(27)25-14-6-9-19(25)18-10-12-22-13-11-18/h3-5,7-8,10-13,19H,2,6,9,14-16H2,1H3,(H,23,27)/t19-/m1/s1 |
| InChIKey | SCFWFPPMNBFTAO-LJQANCHMSA-N |
| XLogP | 2.98 |
| TPSA | 65.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.47 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |