C31H45N5O3 — CID 170789063
(E)-3-(4-butan-2-yl-3-pyridinyl)-N,2-dimethylprop-2-en-1-amine;2-[2,4-dioxo-5-(3-phenylpropylamino)-1H-pyrimidin-3-yl]acetaldehyde;ethane (PubChem CID 170789063) has the molecular formula C31H45N5O3 and a molecular weight of 535.73 g/mol. Its IUPAC name is (E)-3-(4-butan-2-yl-3-pyridinyl)-N,2-dimethylprop-2-en-1-amine;2-[2,4-dioxo-5-(3-phenylpropylamino)-1H-pyrimidin-3-yl]acetaldehyde;ethane.
| Compound Name | (E)-3-(4-butan-2-yl-3-pyridinyl)-N,2-dimethylprop-2-en-1-amine;2-[2,4-dioxo-5-(3-phenylpropylamino)-1H-pyrimidin-3-yl]acetaldehyde;ethane |
|---|---|
| PubChem CID | 170789063 |
| Molecular Formula | C31H45N5O3 |
| Molecular Weight | 535.73 g/mol |
| Exact Mass | 535.35 |
| IUPAC Name | (E)-3-(4-butan-2-yl-3-pyridinyl)-N,2-dimethylprop-2-en-1-amine;2-[2,4-dioxo-5-(3-phenylpropylamino)-1H-pyrimidin-3-yl]acetaldehyde;ethane |
| SMILES | CC.CCC(C)c1ccncc1/C=C(\C)CNC.O=CCn1c(=O)[nH]cc(NCCCc2ccccc2)c1=O |
| InChI | InChI=1S/C15H17N3O3.C14H22N2.C2H6/c19-10-9-18-14(20)13(11-17-15(18)21)16-8-4-7-12-5-2-1-3-6-12;1-5-12(3)14-6-7-16-10-13(14)8-11(2)9-15-4;1-2/h1-3,5-6,10-11,16H,4,7-9H2,(H,17,21);6-8,10,12,15H,5,9H2,1-4H3;1-2H3/b;11-8+; |
| InChIKey | PDRHLKMNJBJMOG-GRQPBFIBSA-N |
| XLogP | 5.02 |
| TPSA | 108.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.73 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|