C37H45N5O2 — CID 170789931
3-(2-cyclobutylideneethyl)-5-(2-phenoxyethylamino)-2-phenylpyrimidin-4-one;(E)-N,2-dimethyl-3-(4-propyl-3-pyridinyl)prop-2-en-1-amine (PubChem CID 170789931) has the molecular formula C37H45N5O2 and a molecular weight of 591.80 g/mol. Its IUPAC name is 3-(2-cyclobutylideneethyl)-5-(2-phenoxyethylamino)-2-phenylpyrimidin-4-one;(E)-N,2-dimethyl-3-(4-propyl-3-pyridinyl)prop-2-en-1-amine.
| Compound Name | 3-(2-cyclobutylideneethyl)-5-(2-phenoxyethylamino)-2-phenylpyrimidin-4-one;(E)-N,2-dimethyl-3-(4-propyl-3-pyridinyl)prop-2-en-1-amine |
|---|---|
| PubChem CID | 170789931 |
| Molecular Formula | C37H45N5O2 |
| Molecular Weight | 591.80 g/mol |
| Exact Mass | 591.36 |
| IUPAC Name | 3-(2-cyclobutylideneethyl)-5-(2-phenoxyethylamino)-2-phenylpyrimidin-4-one;(E)-N,2-dimethyl-3-(4-propyl-3-pyridinyl)prop-2-en-1-amine |
| SMILES | CCCc1ccncc1/C=C(\C)CNC.O=c1c(NCCOc2ccccc2)cnc(-c2ccccc2)n1CC=C1CCC1 |
| InChI | InChI=1S/C24H25N3O2.C13H20N2/c28-24-22(25-15-17-29-21-12-5-2-6-13-21)18-26-23(20-10-3-1-4-11-20)27(24)16-14-19-8-7-9-19;1-4-5-12-6-7-15-10-13(12)8-11(2)9-14-3/h1-6,10-14,18,25H,7-9,15-17H2;6-8,10,14H,4-5,9H2,1-3H3/b;11-8+ |
| InChIKey | XHYIZIMXEGJLRB-IBMQDACXSA-N |
| XLogP | 7.17 |
| TPSA | 81.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 591.80 |
| LogP ≤ 5 | 7.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|