C18H24N2O4 — CID 86628420
tert-butyl 2-(7-methoxy-2-oxo-3-propan-2-ylquinoxalin-1-yl)acetate (PubChem CID 86628420) has the molecular formula C18H24N2O4 and a molecular weight of 332.40 g/mol. Its IUPAC name is tert-butyl 2-(7-methoxy-2-oxo-3-propan-2-ylquinoxalin-1-yl)acetate.
| Compound Name | tert-butyl 2-(7-methoxy-2-oxo-3-propan-2-ylquinoxalin-1-yl)acetate |
|---|---|
| PubChem CID | 86628420 |
| Molecular Formula | C18H24N2O4 |
| Molecular Weight | 332.40 g/mol |
| Exact Mass | 332.17 |
| IUPAC Name | tert-butyl 2-(7-methoxy-2-oxo-3-propan-2-ylquinoxalin-1-yl)acetate |
| SMILES | COc1ccc2nc(C(C)C)c(=O)n(CC(=O)OC(C)(C)C)c2c1 |
| InChI | InChI=1S/C18H24N2O4/c1-11(2)16-17(22)20(10-15(21)24-18(3,4)5)14-9-12(23-6)7-8-13(14)19-16/h7-9,11H,10H2,1-6H3 |
| InChIKey | LQCWRKCKOCXFJD-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 70.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.40 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |