C14H22N2O3 — CID 22178631
tert-butyl 2-(3-amino-2-oxo-6-propan-2-yl-1-pyridinyl)acetate (PubChem CID 22178631) has the molecular formula C14H22N2O3 and a molecular weight of 266.34 g/mol. Its IUPAC name is tert-butyl 2-(3-amino-2-oxo-6-propan-2-yl-1-pyridinyl)acetate.
| Compound Name | tert-butyl 2-(3-amino-2-oxo-6-propan-2-yl-1-pyridinyl)acetate |
|---|---|
| PubChem CID | 22178631 |
| Molecular Formula | C14H22N2O3 |
| Molecular Weight | 266.34 g/mol |
| Exact Mass | 266.16 |
| IUPAC Name | tert-butyl 2-(3-amino-2-oxo-6-propan-2-yl-1-pyridinyl)acetate |
| SMILES | CC(C)c1ccc(N)c(=O)n1CC(=O)OC(C)(C)C |
| InChI | InChI=1S/C14H22N2O3/c1-9(2)11-7-6-10(15)13(18)16(11)8-12(17)19-14(3,4)5/h6-7,9H,8,15H2,1-5H3 |
| InChIKey | FPASJNTZTZPGFO-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 74.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.34 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |