C19H38O2 — CID 176894839
5-methyl-4,4-bis(pentoxymethyl)hex-1-ene (PubChem CID 176894839) has the molecular formula C19H38O2 and a molecular weight of 298.51 g/mol. Its IUPAC name is 5-methyl-4,4-bis(pentoxymethyl)hex-1-ene.
| Compound Name | 5-methyl-4,4-bis(pentoxymethyl)hex-1-ene |
|---|---|
| PubChem CID | 176894839 |
| Molecular Formula | C19H38O2 |
| Molecular Weight | 298.51 g/mol |
| Exact Mass | 298.29 |
| IUPAC Name | 5-methyl-4,4-bis(pentoxymethyl)hex-1-ene |
| SMILES | C=CCC(COCCCCC)(COCCCCC)C(C)C |
| InChI | InChI=1S/C19H38O2/c1-6-9-11-14-20-16-19(13-8-3,18(4)5)17-21-15-12-10-7-2/h8,18H,3,6-7,9-17H2,1-2,4-5H3 |
| InChIKey | SEQDWWICZSLOLA-UHFFFAOYSA-N |
| XLogP | 5.62 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.51 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|