About [3-methyl-2,2-bis(pentoxymethyl)butyl]cyclohexane
[3-methyl-2,2-bis(pentoxymethyl)butyl]cyclohexane (PubChem CID 22372585) has the molecular formula C23H46O2
and a molecular weight of 354.62 g/mol. Its IUPAC name is [3-methyl-2,2-bis(pentoxymethyl)butyl]cyclohexane.
Molecular Properties
| Compound Name | [3-methyl-2,2-bis(pentoxymethyl)butyl]cyclohexane |
| PubChem CID | 22372585 |
| Molecular Formula | C23H46O2 |
| Molecular Weight | 354.62 g/mol |
| Exact Mass | 354.35 |
| IUPAC Name | [3-methyl-2,2-bis(pentoxymethyl)butyl]cyclohexane |
| SMILES | CCCCCOCC(COCCCCC)(CC1CCCCC1)C(C)C |
| InChI | InChI=1S/C23H46O2/c1-5-7-12-16-24-19-23(21(3)4,20-25-17-13-8-6-2)18-22-14-10-9-11-15-22/h21-22H,5-20H2,1-4H3 |
| InChIKey | TVQGDLSHMFPLBT-UHFFFAOYSA-N |
| XLogP | 7.01 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 354.62 |
| LogP ≤ 5 | 7.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze [3-methyl-2,2-bis(pentoxymethyl)butyl]cyclohexane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [3-methyl-2,2-bis(pentoxymethyl)butyl]cyclohexane?
The IUPAC name of [3-methyl-2,2-bis(pentoxymethyl)butyl]cyclohexane (CID 22372585) is [3-methyl-2,2-bis(pentoxymethyl)butyl]cyclohexane.
What is the SMILES notation for [3-methyl-2,2-bis(pentoxymethyl)butyl]cyclohexane?
The canonical SMILES for [3-methyl-2,2-bis(pentoxymethyl)butyl]cyclohexane is CCCCCOCC(COCCCCC)(CC1CCCCC1)C(C)C.
What is the InChIKey of [3-methyl-2,2-bis(pentoxymethyl)butyl]cyclohexane?
The InChIKey is TVQGDLSHMFPLBT-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H46O2/c1-5-7-12-16-24-19-23(21(3)4,20-25-17-13-8-6-2)18-22-14-10-9-11-15-22/h21-22H,5-20H2,1-4H3.
What are the key properties of [3-methyl-2,2-bis(pentoxymethyl)butyl]cyclohexane?
[3-methyl-2,2-bis(pentoxymethyl)butyl]cyclohexane has a molecular weight of 354.62 g/mol, XLogP of 7.01, 15 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for [3-methyl-2,2-bis(pentoxymethyl)butyl]cyclohexane is sourced from PubChem (CID 22372585), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).