C12H14F3N3O2 — CID 176895601
6-[[3-(trifluoromethyl)-1H-pyrazol-5-yl]methyl]-2-azaspiro[3.3]heptane-2-carboxylic acid (PubChem CID 176895601) has the molecular formula C12H14F3N3O2 and a molecular weight of 289.26 g/mol. Its IUPAC name is 6-[[3-(trifluoromethyl)-1H-pyrazol-5-yl]methyl]-2-azaspiro[3.3]heptane-2-carboxylic acid.
| Compound Name | 6-[[3-(trifluoromethyl)-1H-pyrazol-5-yl]methyl]-2-azaspiro[3.3]heptane-2-carboxylic acid |
|---|---|
| PubChem CID | 176895601 |
| Molecular Formula | C12H14F3N3O2 |
| Molecular Weight | 289.26 g/mol |
| Exact Mass | 289.10 |
| IUPAC Name | 6-[[3-(trifluoromethyl)-1H-pyrazol-5-yl]methyl]-2-azaspiro[3.3]heptane-2-carboxylic acid |
| SMILES | O=C(O)N1CC2(CC(Cc3cc(C(F)(F)F)n[nH]3)C2)C1 |
| InChI | InChI=1S/C12H14F3N3O2/c13-12(14,15)9-2-8(16-17-9)1-7-3-11(4-7)5-18(6-11)10(19)20/h2,7H,1,3-6H2,(H,16,17)(H,19,20) |
| InChIKey | LEECPWKTIBACLU-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 69.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.26 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |