C24H48N4O6 — CID 176896502
2-[2-[1,1,2-tris[(2-methylpropan-2-yl)oxy]-2-oxoethyl]-1,4,7,10-tetrazacyclododec-1-yl]acetic acid (PubChem CID 176896502) has the molecular formula C24H48N4O6 and a molecular weight of 488.67 g/mol. Its IUPAC name is 2-[2-[1,1,2-tris[(2-methylpropan-2-yl)oxy]-2-oxoethyl]-1,4,7,10-tetrazacyclododec-1-yl]acetic acid.
| Compound Name | 2-[2-[1,1,2-tris[(2-methylpropan-2-yl)oxy]-2-oxoethyl]-1,4,7,10-tetrazacyclododec-1-yl]acetic acid |
|---|---|
| PubChem CID | 176896502 |
| Molecular Formula | C24H48N4O6 |
| Molecular Weight | 488.67 g/mol |
| Exact Mass | 488.36 |
| IUPAC Name | 2-[2-[1,1,2-tris[(2-methylpropan-2-yl)oxy]-2-oxoethyl]-1,4,7,10-tetrazacyclododec-1-yl]acetic acid |
| SMILES | CC(C)(C)OC(=O)C(OC(C)(C)C)(OC(C)(C)C)C1CNCCNCCNCCN1CC(=O)O |
| InChI | InChI=1S/C24H48N4O6/c1-21(2,3)32-20(31)24(33-22(4,5)6,34-23(7,8)9)18-16-27-13-12-25-10-11-26-14-15-28(18)17-19(29)30/h18,25-27H,10-17H2,1-9H3,(H,29,30) |
| InChIKey | MXHYWRATFVBIAP-UHFFFAOYSA-N |
| XLogP | 1.19 |
| TPSA | 121.39 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.67 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|