About [2-[(4-cyanophenyl)methyl]-2-hydroxy-3,3-dimethylbutyl] carbamate
[2-[(4-cyanophenyl)methyl]-2-hydroxy-3,3-dimethylbutyl] carbamate (PubChem CID 176897264) has the molecular formula C15H20N2O3
and a molecular weight of 276.34 g/mol. Its IUPAC name is [2-[(4-cyanophenyl)methyl]-2-hydroxy-3,3-dimethylbutyl] carbamate.
Molecular Properties
| Compound Name | [2-[(4-cyanophenyl)methyl]-2-hydroxy-3,3-dimethylbutyl] carbamate |
| PubChem CID | 176897264 |
| Molecular Formula | C15H20N2O3 |
| Molecular Weight | 276.34 g/mol |
| Exact Mass | 276.15 |
| IUPAC Name | [2-[(4-cyanophenyl)methyl]-2-hydroxy-3,3-dimethylbutyl] carbamate |
| SMILES | CC(C)(C)C(O)(COC(N)=O)Cc1ccc(C#N)cc1 |
| InChI | InChI=1S/C15H20N2O3/c1-14(2,3)15(19,10-20-13(17)18)8-11-4-6-12(9-16)7-5-11/h4-7,19H,8,10H2,1-3H3,(H2,17,18) |
| InChIKey | XYPSDMIUZBWXIH-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 96.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 276.34 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze [2-[(4-cyanophenyl)methyl]-2-hydroxy-3,3-dimethylbutyl] carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-[(4-cyanophenyl)methyl]-2-hydroxy-3,3-dimethylbutyl] carbamate?
The IUPAC name of [2-[(4-cyanophenyl)methyl]-2-hydroxy-3,3-dimethylbutyl] carbamate (CID 176897264) is [2-[(4-cyanophenyl)methyl]-2-hydroxy-3,3-dimethylbutyl] carbamate.
What is the SMILES notation for [2-[(4-cyanophenyl)methyl]-2-hydroxy-3,3-dimethylbutyl] carbamate?
The canonical SMILES for [2-[(4-cyanophenyl)methyl]-2-hydroxy-3,3-dimethylbutyl] carbamate is CC(C)(C)C(O)(COC(N)=O)Cc1ccc(C#N)cc1.
What is the InChIKey of [2-[(4-cyanophenyl)methyl]-2-hydroxy-3,3-dimethylbutyl] carbamate?
The InChIKey is XYPSDMIUZBWXIH-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H20N2O3/c1-14(2,3)15(19,10-20-13(17)18)8-11-4-6-12(9-16)7-5-11/h4-7,19H,8,10H2,1-3H3,(H2,17,18).
What are the key properties of [2-[(4-cyanophenyl)methyl]-2-hydroxy-3,3-dimethylbutyl] carbamate?
[2-[(4-cyanophenyl)methyl]-2-hydroxy-3,3-dimethylbutyl] carbamate has a molecular weight of 276.34 g/mol, XLogP of 1.97, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [2-[(4-cyanophenyl)methyl]-2-hydroxy-3,3-dimethylbutyl] carbamate is sourced from PubChem (CID 176897264), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).