C28H32O8 — CID 176897336
(9Z,11Z,13Z,15Z)-9,10,11,12,13,14,15,16-octamethylcycloicosa-9,11,13,15-tetraene-1,2,3,4,5,6,7,8-octone (PubChem CID 176897336) has the molecular formula C28H32O8 and a molecular weight of 496.56 g/mol. Its IUPAC name is (9Z,11Z,13Z,15Z)-9,10,11,12,13,14,15,16-octamethylcycloicosa-9,11,13,15-tetraene-1,2,3,4,5,6,7,8-octone.
| Compound Name | (9Z,11Z,13Z,15Z)-9,10,11,12,13,14,15,16-octamethylcycloicosa-9,11,13,15-tetraene-1,2,3,4,5,6,7,8-octone |
|---|---|
| PubChem CID | 176897336 |
| Molecular Formula | C28H32O8 |
| Molecular Weight | 496.56 g/mol |
| Exact Mass | 496.21 |
| IUPAC Name | (9Z,11Z,13Z,15Z)-9,10,11,12,13,14,15,16-octamethylcycloicosa-9,11,13,15-tetraene-1,2,3,4,5,6,7,8-octone |
| SMILES | C/C1=C(C)/C(C)=C(C)\C(C)=C(C)/C(C)=C(/C)C(=O)C(=O)C(=O)C(=O)C(=O)C(=O)C(=O)C(=O)CCCC1 |
| InChI | InChI=1S/C28H32O8/c1-13-11-9-10-12-21(29)23(31)25(33)27(35)28(36)26(34)24(32)22(30)20(8)19(7)18(6)17(5)16(4)15(3)14(13)2/h9-12H2,1-8H3/b14-13-,16-15-,18-17-,20-19- |
| InChIKey | HNHHOBZMNGVDMX-NBRPSZRZSA-N |
| XLogP | 3.46 |
| TPSA | 136.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.56 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|