C19H21F4N5O3S — CID 176902483
(3S,4R)-4-[[4-[2,6-dimethyl-3-(1,1,1-trifluoro-2-hydroxypropan-2-yl)thieno[3,2-c]pyrazol-5-yl]-5-fluoropyrimidin-2-yl]amino]oxan-3-ol (PubChem CID 176902483) has the molecular formula C19H21F4N5O3S and a molecular weight of 475.47 g/mol. Its IUPAC name is (3S,4R)-4-[[4-[2,6-dimethyl-3-(1,1,1-trifluoro-2-hydroxypropan-2-yl)thieno[3,2-c]pyrazol-5-yl]-5-fluoropyrimidin-2-yl]amino]oxan-3-ol.
| Compound Name | (3S,4R)-4-[[4-[2,6-dimethyl-3-(1,1,1-trifluoro-2-hydroxypropan-2-yl)thieno[3,2-c]pyrazol-5-yl]-5-fluoropyrimidin-2-yl]amino]oxan-3-ol |
|---|---|
| PubChem CID | 176902483 |
| Molecular Formula | C19H21F4N5O3S |
| Molecular Weight | 475.47 g/mol |
| Exact Mass | 475.13 |
| IUPAC Name | (3S,4R)-4-[[4-[2,6-dimethyl-3-(1,1,1-trifluoro-2-hydroxypropan-2-yl)thieno[3,2-c]pyrazol-5-yl]-5-fluoropyrimidin-2-yl]amino]oxan-3-ol |
| SMILES | Cc1c(-c2nc(N[C@@H]3CCOC[C@H]3O)ncc2F)sc2c(C(C)(O)C(F)(F)F)n(C)nc12 |
| InChI | InChI=1S/C19H21F4N5O3S/c1-8-12-15(16(28(3)27-12)18(2,30)19(21,22)23)32-14(8)13-9(20)6-24-17(26-13)25-10-4-5-31-7-11(10)29/h6,10-11,29-30H,4-5,7H2,1-3H3,(H,24,25,26)/t10-,11-,18?/m1/s1 |
| InChIKey | QFYJNGXJLVBOIC-LSSOAPJISA-N |
| XLogP | 2.87 |
| TPSA | 105.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.47 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |