C15H14N2O4 — CID 176902597
[3-(4-nitrophenyl)-2,4-dihydro-1,3-benzoxazin-6-yl]methanol (PubChem CID 176902597) has the molecular formula C15H14N2O4 and a molecular weight of 286.29 g/mol. Its IUPAC name is [3-(4-nitrophenyl)-2,4-dihydro-1,3-benzoxazin-6-yl]methanol.
| Compound Name | [3-(4-nitrophenyl)-2,4-dihydro-1,3-benzoxazin-6-yl]methanol |
|---|---|
| PubChem CID | 176902597 |
| Molecular Formula | C15H14N2O4 |
| Molecular Weight | 286.29 g/mol |
| Exact Mass | 286.10 |
| IUPAC Name | [3-(4-nitrophenyl)-2,4-dihydro-1,3-benzoxazin-6-yl]methanol |
| SMILES | O=[N+]([O-])c1ccc(N2COc3ccc(CO)cc3C2)cc1 |
| InChI | InChI=1S/C15H14N2O4/c18-9-11-1-6-15-12(7-11)8-16(10-21-15)13-2-4-14(5-3-13)17(19)20/h1-7,18H,8-10H2 |
| InChIKey | VZHLZLJWADUBMA-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 75.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.29 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|