C19H32N2O4 — CID 176904750
tert-butyl (3aS,6aR)-5-[(2S,5R)-2-methoxycarbonyl-5-methylpyrrolidin-1-yl]-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrole-2-carboxylate (PubChem CID 176904750) has the molecular formula C19H32N2O4 and a molecular weight of 352.48 g/mol. Its IUPAC name is tert-butyl (3aS,6aR)-5-[(2S,5R)-2-methoxycarbonyl-5-methylpyrrolidin-1-yl]-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrole-2-carboxylate.
| Compound Name | tert-butyl (3aS,6aR)-5-[(2S,5R)-2-methoxycarbonyl-5-methylpyrrolidin-1-yl]-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrole-2-carboxylate |
|---|---|
| PubChem CID | 176904750 |
| Molecular Formula | C19H32N2O4 |
| Molecular Weight | 352.48 g/mol |
| Exact Mass | 352.24 |
| IUPAC Name | tert-butyl (3aS,6aR)-5-[(2S,5R)-2-methoxycarbonyl-5-methylpyrrolidin-1-yl]-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrole-2-carboxylate |
| SMILES | COC(=O)[C@@H]1CC[C@@H](C)N1C1C[C@@H]2CN(C(=O)OC(C)(C)C)C[C@@H]2C1 |
| InChI | InChI=1S/C19H32N2O4/c1-12-6-7-16(17(22)24-5)21(12)15-8-13-10-20(11-14(13)9-15)18(23)25-19(2,3)4/h12-16H,6-11H2,1-5H3/t12-,13-,14+,15?,16+/m1/s1 |
| InChIKey | QKIQSYFMPDRGRD-JDOFQRQTSA-N |
| XLogP | 2.66 |
| TPSA | 59.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.48 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |