C16H16N2O6 — CID 176905457
ethyl 2-[2,5-dicyano-4-(2-ethoxy-2-oxoethyl)-3,6-dihydroxyphenyl]acetate (PubChem CID 176905457) has the molecular formula C16H16N2O6 and a molecular weight of 332.31 g/mol. Its IUPAC name is ethyl 2-[2,5-dicyano-4-(2-ethoxy-2-oxoethyl)-3,6-dihydroxyphenyl]acetate.
| Compound Name | ethyl 2-[2,5-dicyano-4-(2-ethoxy-2-oxoethyl)-3,6-dihydroxyphenyl]acetate |
|---|---|
| PubChem CID | 176905457 |
| Molecular Formula | C16H16N2O6 |
| Molecular Weight | 332.31 g/mol |
| Exact Mass | 332.10 |
| IUPAC Name | ethyl 2-[2,5-dicyano-4-(2-ethoxy-2-oxoethyl)-3,6-dihydroxyphenyl]acetate |
| SMILES | CCOC(=O)Cc1c(O)c(C#N)c(CC(=O)OCC)c(O)c1C#N |
| InChI | InChI=1S/C16H16N2O6/c1-3-23-13(19)5-9-11(7-17)16(22)10(6-14(20)24-4-2)12(8-18)15(9)21/h21-22H,3-6H2,1-2H3 |
| InChIKey | SZIDORPDGTVZDI-UHFFFAOYSA-N |
| XLogP | 1.05 |
| TPSA | 140.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.31 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|