C25H29ClN4O4S2 — CID 176907307
1-[1-[4-[3-(3-chloro-4-cyanophenyl)-5,5-dimethyl-4-oxo-2-sulfanylimidazolidin-1-yl]phenyl]piperidin-4-yl]ethanesulfonic acid (PubChem CID 176907307) has the molecular formula C25H29ClN4O4S2 and a molecular weight of 549.12 g/mol. Its IUPAC name is 1-[1-[4-[3-(3-chloro-4-cyanophenyl)-5,5-dimethyl-4-oxo-2-sulfanylimidazolidin-1-yl]phenyl]piperidin-4-yl]ethanesulfonic acid.
| Compound Name | 1-[1-[4-[3-(3-chloro-4-cyanophenyl)-5,5-dimethyl-4-oxo-2-sulfanylimidazolidin-1-yl]phenyl]piperidin-4-yl]ethanesulfonic acid |
|---|---|
| PubChem CID | 176907307 |
| Molecular Formula | C25H29ClN4O4S2 |
| Molecular Weight | 549.12 g/mol |
| Exact Mass | 548.13 |
| IUPAC Name | 1-[1-[4-[3-(3-chloro-4-cyanophenyl)-5,5-dimethyl-4-oxo-2-sulfanylimidazolidin-1-yl]phenyl]piperidin-4-yl]ethanesulfonic acid |
| SMILES | CC(C1CCN(c2ccc(N3C(S)N(c4ccc(C#N)c(Cl)c4)C(=O)C3(C)C)cc2)CC1)S(=O)(=O)O |
| InChI | InChI=1S/C25H29ClN4O4S2/c1-16(36(32,33)34)17-10-12-28(13-11-17)19-6-8-20(9-7-19)30-24(35)29(23(31)25(30,2)3)21-5-4-18(15-27)22(26)14-21/h4-9,14,16-17,24,35H,10-13H2,1-3H3,(H,32,33,34) |
| InChIKey | NEIBUVYYNFXADR-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 104.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.12 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|