C16H22O3Si — CID 176907474
methyl 3-[4-(1-trimethylsilylprop-2-ynoxy)phenyl]propanoate (PubChem CID 176907474) has the molecular formula C16H22O3Si and a molecular weight of 290.44 g/mol. Its IUPAC name is methyl 3-[4-(1-trimethylsilylprop-2-ynoxy)phenyl]propanoate.
| Compound Name | methyl 3-[4-(1-trimethylsilylprop-2-ynoxy)phenyl]propanoate |
|---|---|
| PubChem CID | 176907474 |
| Molecular Formula | C16H22O3Si |
| Molecular Weight | 290.44 g/mol |
| Exact Mass | 290.13 |
| IUPAC Name | methyl 3-[4-(1-trimethylsilylprop-2-ynoxy)phenyl]propanoate |
| SMILES | C#CC(Oc1ccc(CCC(=O)OC)cc1)[Si](C)(C)C |
| InChI | InChI=1S/C16H22O3Si/c1-6-16(20(3,4)5)19-14-10-7-13(8-11-14)9-12-15(17)18-2/h1,7-8,10-11,16H,9,12H2,2-5H3 |
| InChIKey | RNDWHMQDNIZVCP-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.44 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|