C21H14ClN7O2S — CID 176908433
5-(2-chloro-5-methoxy-4-pyridinyl)-N-[6-(2-cyclopropylethynyl)-[1,3]thiazolo[4,5-b]pyrazin-2-yl]pyridazine-4-carboxamide (PubChem CID 176908433) has the molecular formula C21H14ClN7O2S and a molecular weight of 463.91 g/mol. Its IUPAC name is 5-(2-chloro-5-methoxy-4-pyridinyl)-N-[6-(2-cyclopropylethynyl)-[1,3]thiazolo[4,5-b]pyrazin-2-yl]pyridazine-4-carboxamide.
| Compound Name | 5-(2-chloro-5-methoxy-4-pyridinyl)-N-[6-(2-cyclopropylethynyl)-[1,3]thiazolo[4,5-b]pyrazin-2-yl]pyridazine-4-carboxamide |
|---|---|
| PubChem CID | 176908433 |
| Molecular Formula | C21H14ClN7O2S |
| Molecular Weight | 463.91 g/mol |
| Exact Mass | 463.06 |
| IUPAC Name | 5-(2-chloro-5-methoxy-4-pyridinyl)-N-[6-(2-cyclopropylethynyl)-[1,3]thiazolo[4,5-b]pyrazin-2-yl]pyridazine-4-carboxamide |
| SMILES | COc1cnc(Cl)cc1-c1cnncc1C(=O)Nc1nc2ncc(C#CC3CC3)nc2s1 |
| InChI | InChI=1S/C21H14ClN7O2S/c1-31-16-10-23-17(22)6-13(16)14-8-25-26-9-15(14)19(30)29-21-28-18-20(32-21)27-12(7-24-18)5-4-11-2-3-11/h6-11H,2-3H2,1H3,(H,24,28,29,30) |
| InChIKey | UEBCAKZRXHLLDC-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 115.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.91 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|