C24H21ClN6O4S2 — CID 176908434
N-[6-(2,3,3a,4,5,6a-hexahydrofuro[2,3-b]furan-4-ylsulfanyl)-[1,3]thiazolo[4,5-b]pyrazin-2-yl]-4-(2-chloro-5-methoxy-4-pyridinyl)-6-methylpyridine-3-carboxamide (PubChem CID 176908434) has the molecular formula C24H21ClN6O4S2 and a molecular weight of 557.06 g/mol. Its IUPAC name is N-[6-(2,3,3a,4,5,6a-hexahydrofuro[2,3-b]furan-4-ylsulfanyl)-[1,3]thiazolo[4,5-b]pyrazin-2-yl]-4-(2-chloro-5-methoxy-4-pyridinyl)-6-methylpyridine-3-carboxamide.
| Compound Name | N-[6-(2,3,3a,4,5,6a-hexahydrofuro[2,3-b]furan-4-ylsulfanyl)-[1,3]thiazolo[4,5-b]pyrazin-2-yl]-4-(2-chloro-5-methoxy-4-pyridinyl)-6-methylpyridine-3-carboxamide |
|---|---|
| PubChem CID | 176908434 |
| Molecular Formula | C24H21ClN6O4S2 |
| Molecular Weight | 557.06 g/mol |
| Exact Mass | 556.08 |
| IUPAC Name | N-[6-(2,3,3a,4,5,6a-hexahydrofuro[2,3-b]furan-4-ylsulfanyl)-[1,3]thiazolo[4,5-b]pyrazin-2-yl]-4-(2-chloro-5-methoxy-4-pyridinyl)-6-methylpyridine-3-carboxamide |
| SMILES | COc1cnc(Cl)cc1-c1cc(C)ncc1C(=O)Nc1nc2ncc(SC3COC4OCCC43)nc2s1 |
| InChI | InChI=1S/C24H21ClN6O4S2/c1-11-5-13(14-6-18(25)27-8-16(14)33-2)15(7-26-11)21(32)31-24-30-20-22(37-24)29-19(9-28-20)36-17-10-35-23-12(17)3-4-34-23/h5-9,12,17,23H,3-4,10H2,1-2H3,(H,28,30,31,32) |
| InChIKey | FLQXDMAMRSULPD-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 121.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.06 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|