C22H28BrClN6O3 — CID 176909396
4-[[6-(3-bromo-4-chloro-5-methoxyanilino)-9-(3-methoxypropyl)purin-2-yl]amino]cyclohexan-1-ol (PubChem CID 176909396) has the molecular formula C22H28BrClN6O3 and a molecular weight of 539.86 g/mol. Its IUPAC name is 4-[[6-(3-bromo-4-chloro-5-methoxyanilino)-9-(3-methoxypropyl)purin-2-yl]amino]cyclohexan-1-ol.
| Compound Name | 4-[[6-(3-bromo-4-chloro-5-methoxyanilino)-9-(3-methoxypropyl)purin-2-yl]amino]cyclohexan-1-ol |
|---|---|
| PubChem CID | 176909396 |
| Molecular Formula | C22H28BrClN6O3 |
| Molecular Weight | 539.86 g/mol |
| Exact Mass | 538.11 |
| IUPAC Name | 4-[[6-(3-bromo-4-chloro-5-methoxyanilino)-9-(3-methoxypropyl)purin-2-yl]amino]cyclohexan-1-ol |
| SMILES | COCCCn1cnc2c(Nc3cc(Br)c(Cl)c(OC)c3)nc(NC3CCC(O)CC3)nc21 |
| InChI | InChI=1S/C22H28BrClN6O3/c1-32-9-3-8-30-12-25-19-20(26-14-10-16(23)18(24)17(11-14)33-2)28-22(29-21(19)30)27-13-4-6-15(31)7-5-13/h10-13,15,31H,3-9H2,1-2H3,(H2,26,27,28,29) |
| InChIKey | FNTFKGQGIFWLAM-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 106.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.86 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|