C22H28N6O3 — CID 176909254
4-[[9-cyclopropyl-6-(3,5-dimethoxyanilino)purin-2-yl]amino]cyclohexan-1-ol (PubChem CID 176909254) has the molecular formula C22H28N6O3 and a molecular weight of 424.51 g/mol. Its IUPAC name is 4-[[9-cyclopropyl-6-(3,5-dimethoxyanilino)purin-2-yl]amino]cyclohexan-1-ol.
| Compound Name | 4-[[9-cyclopropyl-6-(3,5-dimethoxyanilino)purin-2-yl]amino]cyclohexan-1-ol |
|---|---|
| PubChem CID | 176909254 |
| Molecular Formula | C22H28N6O3 |
| Molecular Weight | 424.51 g/mol |
| Exact Mass | 424.22 |
| IUPAC Name | 4-[[9-cyclopropyl-6-(3,5-dimethoxyanilino)purin-2-yl]amino]cyclohexan-1-ol |
| SMILES | COc1cc(Nc2nc(NC3CCC(O)CC3)nc3c2ncn3C2CC2)cc(OC)c1 |
| InChI | InChI=1S/C22H28N6O3/c1-30-17-9-14(10-18(11-17)31-2)24-20-19-21(28(12-23-19)15-5-6-15)27-22(26-20)25-13-3-7-16(29)8-4-13/h9-13,15-16,29H,3-8H2,1-2H3,(H2,24,25,26,27) |
| InChIKey | HVPYNCRXTJNWOP-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 106.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.51 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |