C15H26N2O7S — CID 176910623
methyl (2R)-3-[(Z)-C-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-N-hydroxycarbonimidoyl]sulfanyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoate (PubChem CID 176910623) has the molecular formula C15H26N2O7S and a molecular weight of 378.45 g/mol. Its IUPAC name is methyl (2R)-3-[(Z)-C-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-N-hydroxycarbonimidoyl]sulfanyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoate.
| Compound Name | methyl (2R)-3-[(Z)-C-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-N-hydroxycarbonimidoyl]sulfanyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoate |
|---|---|
| PubChem CID | 176910623 |
| Molecular Formula | C15H26N2O7S |
| Molecular Weight | 378.45 g/mol |
| Exact Mass | 378.15 |
| IUPAC Name | methyl (2R)-3-[(Z)-C-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-N-hydroxycarbonimidoyl]sulfanyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoate |
| SMILES | COC(=O)[C@H](CS/C(=N\O)[C@H]1COC(C)(C)O1)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C15H26N2O7S/c1-14(2,3)24-13(19)16-9(12(18)21-6)8-25-11(17-20)10-7-22-15(4,5)23-10/h9-10,20H,7-8H2,1-6H3,(H,16,19)/b17-11-/t9-,10+/m0/s1 |
| InChIKey | WKKXUHBVTMISKM-HCQLAPSDSA-N |
| XLogP | 1.73 |
| TPSA | 115.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.45 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|