C20H22N6O2 — CID 176913103
3-[(2-amino-4-pyridinyl)methoxy]-5-(4-morpholin-4-ylphenyl)pyrazin-2-amine (PubChem CID 176913103) has the molecular formula C20H22N6O2 and a molecular weight of 378.44 g/mol. Its IUPAC name is 3-[(2-amino-4-pyridinyl)methoxy]-5-(4-morpholin-4-ylphenyl)pyrazin-2-amine.
| Compound Name | 3-[(2-amino-4-pyridinyl)methoxy]-5-(4-morpholin-4-ylphenyl)pyrazin-2-amine |
|---|---|
| PubChem CID | 176913103 |
| Molecular Formula | C20H22N6O2 |
| Molecular Weight | 378.44 g/mol |
| Exact Mass | 378.18 |
| IUPAC Name | 3-[(2-amino-4-pyridinyl)methoxy]-5-(4-morpholin-4-ylphenyl)pyrazin-2-amine |
| SMILES | Nc1cc(COc2nc(-c3ccc(N4CCOCC4)cc3)cnc2N)ccn1 |
| InChI | InChI=1S/C20H22N6O2/c21-18-11-14(5-6-23-18)13-28-20-19(22)24-12-17(25-20)15-1-3-16(4-2-15)26-7-9-27-10-8-26/h1-6,11-12H,7-10,13H2,(H2,21,23)(H2,22,24) |
| InChIKey | XVUXHORLZJKLCU-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 112.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.44 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |