C24H19ClFN5O2 — CID 176913568
7-chloro-6-fluoro-1-(4-methoxyphenyl)-4-(methylamino)-3-(2-methylindazol-5-yl)-1,8-naphthyridin-2-one (PubChem CID 176913568) has the molecular formula C24H19ClFN5O2 and a molecular weight of 463.90 g/mol. Its IUPAC name is 7-chloro-6-fluoro-1-(4-methoxyphenyl)-4-(methylamino)-3-(2-methylindazol-5-yl)-1,8-naphthyridin-2-one.
| Compound Name | 7-chloro-6-fluoro-1-(4-methoxyphenyl)-4-(methylamino)-3-(2-methylindazol-5-yl)-1,8-naphthyridin-2-one |
|---|---|
| PubChem CID | 176913568 |
| Molecular Formula | C24H19ClFN5O2 |
| Molecular Weight | 463.90 g/mol |
| Exact Mass | 463.12 |
| IUPAC Name | 7-chloro-6-fluoro-1-(4-methoxyphenyl)-4-(methylamino)-3-(2-methylindazol-5-yl)-1,8-naphthyridin-2-one |
| SMILES | CNc1c(-c2ccc3nn(C)cc3c2)c(=O)n(-c2ccc(OC)cc2)c2nc(Cl)c(F)cc12 |
| InChI | InChI=1S/C24H19ClFN5O2/c1-27-21-17-11-18(26)22(25)28-23(17)31(15-5-7-16(33-3)8-6-15)24(32)20(21)13-4-9-19-14(10-13)12-30(2)29-19/h4-12,27H,1-3H3 |
| InChIKey | PDPHGOLKSRVJJJ-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 73.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.90 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|