C13H9ClFNO4 — CID 176914450
2-[[5-(3-chloro-5-fluorophenyl)furan-2-carbonyl]amino]acetic acid (PubChem CID 176914450) has the molecular formula C13H9ClFNO4 and a molecular weight of 297.67 g/mol. Its IUPAC name is 2-[[5-(3-chloro-5-fluorophenyl)furan-2-carbonyl]amino]acetic acid.
| Compound Name | 2-[[5-(3-chloro-5-fluorophenyl)furan-2-carbonyl]amino]acetic acid |
|---|---|
| PubChem CID | 176914450 |
| Molecular Formula | C13H9ClFNO4 |
| Molecular Weight | 297.67 g/mol |
| Exact Mass | 297.02 |
| IUPAC Name | 2-[[5-(3-chloro-5-fluorophenyl)furan-2-carbonyl]amino]acetic acid |
| SMILES | O=C(O)CNC(=O)c1ccc(-c2cc(F)cc(Cl)c2)o1 |
| InChI | InChI=1S/C13H9ClFNO4/c14-8-3-7(4-9(15)5-8)10-1-2-11(20-10)13(19)16-6-12(17)18/h1-5H,6H2,(H,16,19)(H,17,18) |
| InChIKey | MCDSILRCNJAEKF-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 79.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.67 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |