C20H16F2N4O4 — CID 141162980
2-amino-N-benzamido-N-[[5-(3,5-difluorophenyl)furan-2-carbonyl]amino]acetamide (PubChem CID 141162980) has the molecular formula C20H16F2N4O4 and a molecular weight of 414.37 g/mol. Its IUPAC name is 2-amino-N-benzamido-N-[[5-(3,5-difluorophenyl)furan-2-carbonyl]amino]acetamide.
| Compound Name | 2-amino-N-benzamido-N-[[5-(3,5-difluorophenyl)furan-2-carbonyl]amino]acetamide |
|---|---|
| PubChem CID | 141162980 |
| Molecular Formula | C20H16F2N4O4 |
| Molecular Weight | 414.37 g/mol |
| Exact Mass | 414.11 |
| IUPAC Name | 2-amino-N-benzamido-N-[[5-(3,5-difluorophenyl)furan-2-carbonyl]amino]acetamide |
| SMILES | NCC(=O)N(NC(=O)c1ccccc1)NC(=O)c1ccc(-c2cc(F)cc(F)c2)o1 |
| InChI | InChI=1S/C20H16F2N4O4/c21-14-8-13(9-15(22)10-14)16-6-7-17(30-16)20(29)25-26(18(27)11-23)24-19(28)12-4-2-1-3-5-12/h1-10H,11,23H2,(H,24,28)(H,25,29) |
| InChIKey | JKTJZNMRAAIBLE-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 117.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.37 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|