C21H16F3N5O6 — CID 141162978
2-amino-N-[(4-nitrobenzoyl)amino]-N-[[5-[2-(trifluoromethyl)phenyl]furan-2-carbonyl]amino]acetamide (PubChem CID 141162978) has the molecular formula C21H16F3N5O6 and a molecular weight of 491.38 g/mol. Its IUPAC name is 2-amino-N-[(4-nitrobenzoyl)amino]-N-[[5-[2-(trifluoromethyl)phenyl]furan-2-carbonyl]amino]acetamide.
| Compound Name | 2-amino-N-[(4-nitrobenzoyl)amino]-N-[[5-[2-(trifluoromethyl)phenyl]furan-2-carbonyl]amino]acetamide |
|---|---|
| PubChem CID | 141162978 |
| Molecular Formula | C21H16F3N5O6 |
| Molecular Weight | 491.38 g/mol |
| Exact Mass | 491.11 |
| IUPAC Name | 2-amino-N-[(4-nitrobenzoyl)amino]-N-[[5-[2-(trifluoromethyl)phenyl]furan-2-carbonyl]amino]acetamide |
| SMILES | NCC(=O)N(NC(=O)c1ccc([N+](=O)[O-])cc1)NC(=O)c1ccc(-c2ccccc2C(F)(F)F)o1 |
| InChI | InChI=1S/C21H16F3N5O6/c22-21(23,24)15-4-2-1-3-14(15)16-9-10-17(35-16)20(32)27-28(18(30)11-25)26-19(31)12-5-7-13(8-6-12)29(33)34/h1-10H,11,25H2,(H,26,31)(H,27,32) |
| InChIKey | KUKYEYJIELEPOP-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 160.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.38 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|