C34H26F3N2O2P — CID 176914684
N'-[(R)-(2-diphenylphosphanylphenyl)-phenylmethyl]-N-[4-(trifluoromethyl)phenyl]oxamide (PubChem CID 176914684) has the molecular formula C34H26F3N2O2P and a molecular weight of 582.56 g/mol. Its IUPAC name is N'-[(R)-(2-diphenylphosphanylphenyl)-phenylmethyl]-N-[4-(trifluoromethyl)phenyl]oxamide.
| Compound Name | N'-[(R)-(2-diphenylphosphanylphenyl)-phenylmethyl]-N-[4-(trifluoromethyl)phenyl]oxamide |
|---|---|
| PubChem CID | 176914684 |
| Molecular Formula | C34H26F3N2O2P |
| Molecular Weight | 582.56 g/mol |
| Exact Mass | 582.17 |
| IUPAC Name | N'-[(R)-(2-diphenylphosphanylphenyl)-phenylmethyl]-N-[4-(trifluoromethyl)phenyl]oxamide |
| SMILES | O=C(Nc1ccc(C(F)(F)F)cc1)C(=O)N[C@H](c1ccccc1)c1ccccc1P(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C34H26F3N2O2P/c35-34(36,37)25-20-22-26(23-21-25)38-32(40)33(41)39-31(24-12-4-1-5-13-24)29-18-10-11-19-30(29)42(27-14-6-2-7-15-27)28-16-8-3-9-17-28/h1-23,31H,(H,38,40)(H,39,41)/t31-/m1/s1 |
| InChIKey | BLHPWLBPLWAUSF-WJOKGBTCSA-N |
| XLogP | 6.31 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 582.56 |
| LogP ≤ 5 | 6.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|