C29H26N4O4 — CID 176914765
1-benzoyl-N-(2,2'-dioxospiro[1,4-dihydroquinoline-3,3'-1H-indole]-6'-yl)piperidine-4-carboxamide (PubChem CID 176914765) has the molecular formula C29H26N4O4 and a molecular weight of 494.55 g/mol. Its IUPAC name is 1-benzoyl-N-(2,2'-dioxospiro[1,4-dihydroquinoline-3,3'-1H-indole]-6'-yl)piperidine-4-carboxamide.
| Compound Name | 1-benzoyl-N-(2,2'-dioxospiro[1,4-dihydroquinoline-3,3'-1H-indole]-6'-yl)piperidine-4-carboxamide |
|---|---|
| PubChem CID | 176914765 |
| Molecular Formula | C29H26N4O4 |
| Molecular Weight | 494.55 g/mol |
| Exact Mass | 494.20 |
| IUPAC Name | 1-benzoyl-N-(2,2'-dioxospiro[1,4-dihydroquinoline-3,3'-1H-indole]-6'-yl)piperidine-4-carboxamide |
| SMILES | O=C(Nc1ccc2c(c1)NC(=O)C21Cc2ccccc2NC1=O)C1CCN(C(=O)c2ccccc2)CC1 |
| InChI | InChI=1S/C29H26N4O4/c34-25(18-12-14-33(15-13-18)26(35)19-6-2-1-3-7-19)30-21-10-11-22-24(16-21)32-28(37)29(22)17-20-8-4-5-9-23(20)31-27(29)36/h1-11,16,18H,12-15,17H2,(H,30,34)(H,31,36)(H,32,37) |
| InChIKey | UGLFMEWCMWHHON-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 107.61 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 37 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.55 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|