C29H25N5O6 — CID 176914766
N-(2,2'-dioxospiro[1,4-dihydroquinoline-3,3'-1H-indole]-6'-yl)-1-(2-nitrobenzoyl)piperidine-4-carboxamide (PubChem CID 176914766) has the molecular formula C29H25N5O6 and a molecular weight of 539.55 g/mol. Its IUPAC name is N-(2,2'-dioxospiro[1,4-dihydroquinoline-3,3'-1H-indole]-6'-yl)-1-(2-nitrobenzoyl)piperidine-4-carboxamide.
| Compound Name | N-(2,2'-dioxospiro[1,4-dihydroquinoline-3,3'-1H-indole]-6'-yl)-1-(2-nitrobenzoyl)piperidine-4-carboxamide |
|---|---|
| PubChem CID | 176914766 |
| Molecular Formula | C29H25N5O6 |
| Molecular Weight | 539.55 g/mol |
| Exact Mass | 539.18 |
| IUPAC Name | N-(2,2'-dioxospiro[1,4-dihydroquinoline-3,3'-1H-indole]-6'-yl)-1-(2-nitrobenzoyl)piperidine-4-carboxamide |
| SMILES | O=C(Nc1ccc2c(c1)NC(=O)C21Cc2ccccc2NC1=O)C1CCN(C(=O)c2ccccc2[N+](=O)[O-])CC1 |
| InChI | InChI=1S/C29H25N5O6/c35-25(17-11-13-33(14-12-17)26(36)20-6-2-4-8-24(20)34(39)40)30-19-9-10-21-23(15-19)32-28(38)29(21)16-18-5-1-3-7-22(18)31-27(29)37/h1-10,15,17H,11-14,16H2,(H,30,35)(H,31,37)(H,32,38) |
| InChIKey | XDNNWAIHYFCSFO-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 150.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.55 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|