C14H11BrN2O — CID 176916107
8-bromo-2,6-dimethylbenzo[h][1,6]naphthyridin-5-one (PubChem CID 176916107) has the molecular formula C14H11BrN2O and a molecular weight of 303.16 g/mol. Its IUPAC name is 8-bromo-2,6-dimethylbenzo[h][1,6]naphthyridin-5-one.
| Compound Name | 8-bromo-2,6-dimethylbenzo[h][1,6]naphthyridin-5-one |
|---|---|
| PubChem CID | 176916107 |
| Molecular Formula | C14H11BrN2O |
| Molecular Weight | 303.16 g/mol |
| Exact Mass | 302.01 |
| IUPAC Name | 8-bromo-2,6-dimethylbenzo[h][1,6]naphthyridin-5-one |
| SMILES | Cc1ccc2c(=O)n(C)c3cc(Br)ccc3c2n1 |
| InChI | InChI=1S/C14H11BrN2O/c1-8-3-5-11-13(16-8)10-6-4-9(15)7-12(10)17(2)14(11)18/h3-7H,1-2H3 |
| InChIKey | ZDDARWVKPPEGFI-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 34.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.16 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|