About CID 176917267
CID 176917267 (PubChem CID 176917267) has the molecular formula C39H11B14N3S
and a molecular weight of 704.97 g/mol.
Molecular Properties
| Compound Name | CID 176917267 |
| PubChem CID | 176917267 |
| Molecular Formula | C39H11B14N3S |
| Molecular Weight | 704.97 g/mol |
| Exact Mass | 707.20 |
| IUPAC Name | — |
| SMILES | [B]c1c([B])c([B])c(-c2nc(-c3c([B])c([B])c([B])c([B])c3[B])nc(-c3c([B])c([B])c([B])c(-c4cccc5c4sc4c(-c6ccccc6)cccc45)c3[B])n2)c([B])c1[B] |
| InChI | InChI=1S/C39H11B14N3S/c40-21-17(16-11-5-10-15-14-9-4-8-13(35(14)57-36(15)16)12-6-2-1-3-7-12)22(41)28(47)23(42)18(21)37-54-38(19-24(43)29(48)33(52)30(49)25(19)44)56-39(55-37)20-26(45)31(50)34(53)32(51)27(20)46/h1-11H |
| InChIKey | RZVVCCPAVDEEJK-UHFFFAOYSA-N |
| XLogP | -6.31 |
| TPSA | 38.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 57 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 704.97 |
| LogP ≤ 5 | -6.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 176917267 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 176917267?
The IUPAC name of CID 176917267 (CID 176917267) is not available.
What is the SMILES notation for CID 176917267?
The canonical SMILES for CID 176917267 is [B]c1c([B])c([B])c(-c2nc(-c3c([B])c([B])c([B])c([B])c3[B])nc(-c3c([B])c([B])c([B])c(-c4cccc5c4sc4c(-c6ccccc6)cccc45)c3[B])n2)c([B])c1[B].
What is the InChIKey of CID 176917267?
The InChIKey is RZVVCCPAVDEEJK-UHFFFAOYSA-N. The full InChI is InChI=1S/C39H11B14N3S/c40-21-17(16-11-5-10-15-14-9-4-8-13(35(14)57-36(15)16)12-6-2-1-3-7-12)22(41)28(47)23(42)18(21)37-54-38(19-24(43)29(48)33(52)30(49)25(19)44)56-39(55-37)20-26(45)31(50)34(53)32(51)27(20)46/h1-11H.
What are the key properties of CID 176917267?
CID 176917267 has a molecular weight of 704.97 g/mol, XLogP of -6.31, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for CID 176917267 is sourced from PubChem (CID 176917267), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).