C22H27N4O6P — CID 176918305
2-[1-[3-[(3,4-dihydroxyphenyl)methyl]-7-methoxy-4-oxopyrido[3,4-d]pyridazin-5-yl]piperidin-4-yl]ethylphosphonous acid (PubChem CID 176918305) has the molecular formula C22H27N4O6P and a molecular weight of 474.45 g/mol. Its IUPAC name is 2-[1-[3-[(3,4-dihydroxyphenyl)methyl]-7-methoxy-4-oxopyrido[3,4-d]pyridazin-5-yl]piperidin-4-yl]ethylphosphonous acid.
| Compound Name | 2-[1-[3-[(3,4-dihydroxyphenyl)methyl]-7-methoxy-4-oxopyrido[3,4-d]pyridazin-5-yl]piperidin-4-yl]ethylphosphonous acid |
|---|---|
| PubChem CID | 176918305 |
| Molecular Formula | C22H27N4O6P |
| Molecular Weight | 474.45 g/mol |
| Exact Mass | 474.17 |
| IUPAC Name | 2-[1-[3-[(3,4-dihydroxyphenyl)methyl]-7-methoxy-4-oxopyrido[3,4-d]pyridazin-5-yl]piperidin-4-yl]ethylphosphonous acid |
| SMILES | COc1cc2cnn(Cc3ccc(O)c(O)c3)c(=O)c2c(N2CCC(CCP(O)O)CC2)n1 |
| InChI | InChI=1S/C22H27N4O6P/c1-32-19-11-16-12-23-26(13-15-2-3-17(27)18(28)10-15)22(29)20(16)21(24-19)25-7-4-14(5-8-25)6-9-33(30)31/h2-3,10-12,14,27-28,30-31H,4-9,13H2,1H3 |
| InChIKey | ROABNEVFTAXGNW-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 141.17 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.45 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|