C16H23N4O6PS — CID 176918550
2-[1-(7-methoxy-3-methylsulfonyl-4-oxopyrido[3,4-d]pyridazin-5-yl)piperidin-4-yl]ethylphosphonous acid (PubChem CID 176918550) has the molecular formula C16H23N4O6PS and a molecular weight of 430.42 g/mol. Its IUPAC name is 2-[1-(7-methoxy-3-methylsulfonyl-4-oxopyrido[3,4-d]pyridazin-5-yl)piperidin-4-yl]ethylphosphonous acid.
| Compound Name | 2-[1-(7-methoxy-3-methylsulfonyl-4-oxopyrido[3,4-d]pyridazin-5-yl)piperidin-4-yl]ethylphosphonous acid |
|---|---|
| PubChem CID | 176918550 |
| Molecular Formula | C16H23N4O6PS |
| Molecular Weight | 430.42 g/mol |
| Exact Mass | 430.11 |
| IUPAC Name | 2-[1-(7-methoxy-3-methylsulfonyl-4-oxopyrido[3,4-d]pyridazin-5-yl)piperidin-4-yl]ethylphosphonous acid |
| SMILES | COc1cc2cnn(S(C)(=O)=O)c(=O)c2c(N2CCC(CCP(O)O)CC2)n1 |
| InChI | InChI=1S/C16H23N4O6PS/c1-26-13-9-12-10-17-20(28(2,24)25)16(21)14(12)15(18-13)19-6-3-11(4-7-19)5-8-27(22)23/h9-11,22-23H,3-8H2,1-2H3 |
| InChIKey | YRFWXKXXHXVJEO-UHFFFAOYSA-N |
| XLogP | 0.51 |
| TPSA | 134.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.42 |
| LogP ≤ 5 | 0.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|