C23H28N5O6P — CID 176918350
2-[1-[3-(2-anilino-2-oxoethyl)-5-methoxy-4-oxopyrido[3,4-d]pyridazin-7-yl]piperidin-4-yl]ethylphosphonic acid (PubChem CID 176918350) has the molecular formula C23H28N5O6P and a molecular weight of 501.48 g/mol. Its IUPAC name is 2-[1-[3-(2-anilino-2-oxoethyl)-5-methoxy-4-oxopyrido[3,4-d]pyridazin-7-yl]piperidin-4-yl]ethylphosphonic acid.
| Compound Name | 2-[1-[3-(2-anilino-2-oxoethyl)-5-methoxy-4-oxopyrido[3,4-d]pyridazin-7-yl]piperidin-4-yl]ethylphosphonic acid |
|---|---|
| PubChem CID | 176918350 |
| Molecular Formula | C23H28N5O6P |
| Molecular Weight | 501.48 g/mol |
| Exact Mass | 501.18 |
| IUPAC Name | 2-[1-[3-(2-anilino-2-oxoethyl)-5-methoxy-4-oxopyrido[3,4-d]pyridazin-7-yl]piperidin-4-yl]ethylphosphonic acid |
| SMILES | COc1nc(N2CCC(CCP(=O)(O)O)CC2)cc2cnn(CC(=O)Nc3ccccc3)c(=O)c12 |
| InChI | InChI=1S/C23H28N5O6P/c1-34-22-21-17(13-19(26-22)27-10-7-16(8-11-27)9-12-35(31,32)33)14-24-28(23(21)30)15-20(29)25-18-5-3-2-4-6-18/h2-6,13-14,16H,7-12,15H2,1H3,(H,25,29)(H2,31,32,33) |
| InChIKey | XYHBLHMGLXOMIP-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 146.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.48 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|